C9H14Cl2 — CID 155470137
(1Z,5E)-1,2-dichloro-3,4-dimethylhepta-1,5-diene (PubChem CID 155470137) has the molecular formula C9H14Cl2 and a molecular weight of 193.12 g/mol. Its IUPAC name is (1Z,5E)-1,2-dichloro-3,4-dimethylhepta-1,5-diene.
| Compound Name | (1Z,5E)-1,2-dichloro-3,4-dimethylhepta-1,5-diene |
|---|---|
| PubChem CID | 155470137 |
| Molecular Formula | C9H14Cl2 |
| Molecular Weight | 193.12 g/mol |
| Exact Mass | 192.05 |
| IUPAC Name | (1Z,5E)-1,2-dichloro-3,4-dimethylhepta-1,5-diene |
| SMILES | C/C=C/C(C)C(C)/C(Cl)=C/Cl |
| InChI | InChI=1S/C9H14Cl2/c1-4-5-7(2)8(3)9(11)6-10/h4-8H,1-3H3/b5-4+,9-6- |
| InChIKey | BOSLFWPOHDQJMA-WEHQGULRSA-N |
| XLogP | 4.15 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.12 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|