C13H21Cl2NO — CID 155470189
(2,2-dichloro-1-methylcyclopropyl)-(4-propan-2-ylpiperidin-1-yl)methanone (PubChem CID 155470189) has the molecular formula C13H21Cl2NO and a molecular weight of 278.22 g/mol. Its IUPAC name is (2,2-dichloro-1-methylcyclopropyl)-(4-propan-2-ylpiperidin-1-yl)methanone.
| Compound Name | (2,2-dichloro-1-methylcyclopropyl)-(4-propan-2-ylpiperidin-1-yl)methanone |
|---|---|
| PubChem CID | 155470189 |
| Molecular Formula | C13H21Cl2NO |
| Molecular Weight | 278.22 g/mol |
| Exact Mass | 277.10 |
| IUPAC Name | (2,2-dichloro-1-methylcyclopropyl)-(4-propan-2-ylpiperidin-1-yl)methanone |
| SMILES | CC(C)C1CCN(C(=O)C2(C)CC2(Cl)Cl)CC1 |
| InChI | InChI=1S/C13H21Cl2NO/c1-9(2)10-4-6-16(7-5-10)11(17)12(3)8-13(12,14)15/h9-10H,4-8H2,1-3H3 |
| InChIKey | KZBZFPWUWQPQEE-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.22 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|