C11H16Cl2N2O2 — CID 30534375
1-[(1S)-2,2-dichloro-1-methylcyclopropanecarbonyl]piperidine-4-carboxamide (PubChem CID 30534375) has the molecular formula C11H16Cl2N2O2 and a molecular weight of 279.17 g/mol. Its IUPAC name is 1-[(1S)-2,2-dichloro-1-methylcyclopropanecarbonyl]piperidine-4-carboxamide.
| Compound Name | 1-[(1S)-2,2-dichloro-1-methylcyclopropanecarbonyl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 30534375 |
| Molecular Formula | C11H16Cl2N2O2 |
| Molecular Weight | 279.17 g/mol |
| Exact Mass | 278.06 |
| IUPAC Name | 1-[(1S)-2,2-dichloro-1-methylcyclopropanecarbonyl]piperidine-4-carboxamide |
| SMILES | C[C@@]1(C(=O)N2CCC(C(N)=O)CC2)CC1(Cl)Cl |
| InChI | InChI=1S/C11H16Cl2N2O2/c1-10(6-11(10,12)13)9(17)15-4-2-7(3-5-15)8(14)16/h7H,2-6H2,1H3,(H2,14,16)/t10-/m0/s1 |
| InChIKey | LXWXSKPAXBZJBB-JTQLQIEISA-N |
| XLogP | 1.29 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.17 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|