About 1-[(1S)-2,2-dichloro-1-methylcyclopropanecarbonyl]piperidine-4-carboxamide
1-[(1S)-2,2-dichloro-1-methylcyclopropanecarbonyl]piperidine-4-carboxamide (PubChem CID 30534375) has the molecular formula C11H16Cl2N2O2
and a molecular weight of 279.17 g/mol. Its IUPAC name is 1-[(1S)-2,2-dichloro-1-methylcyclopropanecarbonyl]piperidine-4-carboxamide.
Molecular Properties
| Compound Name | 1-[(1S)-2,2-dichloro-1-methylcyclopropanecarbonyl]piperidine-4-carboxamide |
| PubChem CID | 30534375 |
| Molecular Formula | C11H16Cl2N2O2 |
| Molecular Weight | 279.17 g/mol |
| Exact Mass | 278.06 |
| IUPAC Name | 1-[(1S)-2,2-dichloro-1-methylcyclopropanecarbonyl]piperidine-4-carboxamide |
| SMILES | C[C@@]1(C(=O)N2CCC(C(N)=O)CC2)CC1(Cl)Cl |
| InChI | InChI=1S/C11H16Cl2N2O2/c1-10(6-11(10,12)13)9(17)15-4-2-7(3-5-15)8(14)16/h7H,2-6H2,1H3,(H2,14,16)/t10-/m0/s1 |
| InChIKey | LXWXSKPAXBZJBB-JTQLQIEISA-N |
| XLogP | 1.29 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 279.17 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 1-[(1S)-2,2-dichloro-1-methylcyclopropanecarbonyl]piperidine-4-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(1S)-2,2-dichloro-1-methylcyclopropanecarbonyl]piperidine-4-carboxamide?
The IUPAC name of 1-[(1S)-2,2-dichloro-1-methylcyclopropanecarbonyl]piperidine-4-carboxamide (CID 30534375) is 1-[(1S)-2,2-dichloro-1-methylcyclopropanecarbonyl]piperidine-4-carboxamide.
What is the SMILES notation for 1-[(1S)-2,2-dichloro-1-methylcyclopropanecarbonyl]piperidine-4-carboxamide?
The canonical SMILES for 1-[(1S)-2,2-dichloro-1-methylcyclopropanecarbonyl]piperidine-4-carboxamide is C[C@@]1(C(=O)N2CCC(C(N)=O)CC2)CC1(Cl)Cl.
What is the InChIKey of 1-[(1S)-2,2-dichloro-1-methylcyclopropanecarbonyl]piperidine-4-carboxamide?
The InChIKey is LXWXSKPAXBZJBB-JTQLQIEISA-N. The full InChI is InChI=1S/C11H16Cl2N2O2/c1-10(6-11(10,12)13)9(17)15-4-2-7(3-5-15)8(14)16/h7H,2-6H2,1H3,(H2,14,16)/t10-/m0/s1.
What are the key properties of 1-[(1S)-2,2-dichloro-1-methylcyclopropanecarbonyl]piperidine-4-carboxamide?
1-[(1S)-2,2-dichloro-1-methylcyclopropanecarbonyl]piperidine-4-carboxamide has a molecular weight of 279.17 g/mol, XLogP of 1.29, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(1S)-2,2-dichloro-1-methylcyclopropanecarbonyl]piperidine-4-carboxamide is sourced from PubChem (CID 30534375), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).