C8H11Cl3N2O2 — CID 17311906
1-(2,2,2-trichloroacetyl)piperidine-4-carboxamide (PubChem CID 17311906) has the molecular formula C8H11Cl3N2O2 and a molecular weight of 273.55 g/mol. Its IUPAC name is 1-(2,2,2-trichloroacetyl)piperidine-4-carboxamide.
| Compound Name | 1-(2,2,2-trichloroacetyl)piperidine-4-carboxamide |
|---|---|
| PubChem CID | 17311906 |
| Molecular Formula | C8H11Cl3N2O2 |
| Molecular Weight | 273.55 g/mol |
| Exact Mass | 271.99 |
| IUPAC Name | 1-(2,2,2-trichloroacetyl)piperidine-4-carboxamide |
| SMILES | NC(=O)C1CCN(C(=O)C(Cl)(Cl)Cl)CC1 |
| InChI | InChI=1S/C8H11Cl3N2O2/c9-8(10,11)7(15)13-3-1-5(2-4-13)6(12)14/h5H,1-4H2,(H2,12,14) |
| InChIKey | GBSLRFHYLCXONQ-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.55 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|