C13H18Cl2N2O4 — CID 9454652
[2-(4-carbamoylpiperidin-1-yl)-2-oxoethyl] (1S)-2,2-dichloro-1-methylcyclopropane-1-carboxylate (PubChem CID 9454652) has the molecular formula C13H18Cl2N2O4 and a molecular weight of 337.20 g/mol. Its IUPAC name is [2-(4-carbamoylpiperidin-1-yl)-2-oxoethyl] (1S)-2,2-dichloro-1-methylcyclopropane-1-carboxylate.
| Compound Name | [2-(4-carbamoylpiperidin-1-yl)-2-oxoethyl] (1S)-2,2-dichloro-1-methylcyclopropane-1-carboxylate |
|---|---|
| PubChem CID | 9454652 |
| Molecular Formula | C13H18Cl2N2O4 |
| Molecular Weight | 337.20 g/mol |
| Exact Mass | 336.06 |
| IUPAC Name | [2-(4-carbamoylpiperidin-1-yl)-2-oxoethyl] (1S)-2,2-dichloro-1-methylcyclopropane-1-carboxylate |
| SMILES | C[C@@]1(C(=O)OCC(=O)N2CCC(C(N)=O)CC2)CC1(Cl)Cl |
| InChI | InChI=1S/C13H18Cl2N2O4/c1-12(7-13(12,14)15)11(20)21-6-9(18)17-4-2-8(3-5-17)10(16)19/h8H,2-7H2,1H3,(H2,16,19)/t12-/m0/s1 |
| InChIKey | NJXHSJPQNPCGEL-LBPRGKRZSA-N |
| XLogP | 0.84 |
| TPSA | 89.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.20 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|