C13H19Cl2NO3 — CID 55319161
[2-(4-methylpiperidin-1-yl)-2-oxoethyl] 2,2-dichloro-1-methylcyclopropane-1-carboxylate (PubChem CID 55319161) has the molecular formula C13H19Cl2NO3 and a molecular weight of 308.21 g/mol. Its IUPAC name is [2-(4-methylpiperidin-1-yl)-2-oxoethyl] 2,2-dichloro-1-methylcyclopropane-1-carboxylate.
| Compound Name | [2-(4-methylpiperidin-1-yl)-2-oxoethyl] 2,2-dichloro-1-methylcyclopropane-1-carboxylate |
|---|---|
| PubChem CID | 55319161 |
| Molecular Formula | C13H19Cl2NO3 |
| Molecular Weight | 308.21 g/mol |
| Exact Mass | 307.07 |
| IUPAC Name | [2-(4-methylpiperidin-1-yl)-2-oxoethyl] 2,2-dichloro-1-methylcyclopropane-1-carboxylate |
| SMILES | CC1CCN(C(=O)COC(=O)C2(C)CC2(Cl)Cl)CC1 |
| InChI | InChI=1S/C13H19Cl2NO3/c1-9-3-5-16(6-4-9)10(17)7-19-11(18)12(2)8-13(12,14)15/h9H,3-8H2,1-2H3 |
| InChIKey | XTUITKSNEHGFTH-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.21 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|