C37H46N4O6S — CID 155470302
ethyl (E)-4-[[(2S)-4-methyl-2-[[(2S)-2-[(3-methylthiophene-2-carbonyl)amino]-3-naphthalen-1-ylpropanoyl]amino]pentanoyl]amino]-5-[(3S)-2-oxopiperidin-3-yl]pent-2-enoate (PubChem CID 155470302) has the molecular formula C37H46N4O6S and a molecular weight of 674.86 g/mol. Its IUPAC name is ethyl (E)-4-[[(2S)-4-methyl-2-[[(2S)-2-[(3-methylthiophene-2-carbonyl)amino]-3-naphthalen-1-ylpropanoyl]amino]pentanoyl]amino]-5-[(3S)-2-oxopiperidin-3-yl]pent-2-enoate.
| Compound Name | ethyl (E)-4-[[(2S)-4-methyl-2-[[(2S)-2-[(3-methylthiophene-2-carbonyl)amino]-3-naphthalen-1-ylpropanoyl]amino]pentanoyl]amino]-5-[(3S)-2-oxopiperidin-3-yl]pent-2-enoate |
|---|---|
| PubChem CID | 155470302 |
| Molecular Formula | C37H46N4O6S |
| Molecular Weight | 674.86 g/mol |
| Exact Mass | 674.31 |
| IUPAC Name | ethyl (E)-4-[[(2S)-4-methyl-2-[[(2S)-2-[(3-methylthiophene-2-carbonyl)amino]-3-naphthalen-1-ylpropanoyl]amino]pentanoyl]amino]-5-[(3S)-2-oxopiperidin-3-yl]pent-2-enoate |
| SMILES | CCOC(=O)/C=C/C(C[C@@H]1CCCNC1=O)NC(=O)[C@H](CC(C)C)NC(=O)[C@H](Cc1cccc2ccccc12)NC(=O)c1sccc1C |
| InChI | InChI=1S/C37H46N4O6S/c1-5-47-32(42)16-15-28(21-27-13-9-18-38-34(27)43)39-35(44)30(20-23(2)3)40-36(45)31(41-37(46)33-24(4)17-19-48-33)22-26-12-8-11-25-10-6-7-14-29(25)26/h6-8,10-12,14-17,19,23,27-28,30-31H,5,9,13,18,20-22H2,1-4H3,(H,38,43)(H,39,44)(H,40,45)(H,41,46)/b16-15+/t27-,28?,30-,31-/m0/s1 |
| InChIKey | XMQQJTSOTDIJBD-GVKZCLLPSA-N |
| XLogP | 4.60 |
| TPSA | 142.70 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 48 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 674.86 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|