C23H27N3O4 — CID 142102634
ethyl (E)-4-[(3-aminonaphthalene-2-carbonyl)amino]-5-(2-oxopiperidin-3-yl)pent-2-enoate (PubChem CID 142102634) has the molecular formula C23H27N3O4 and a molecular weight of 409.49 g/mol. Its IUPAC name is ethyl (E)-4-[(3-aminonaphthalene-2-carbonyl)amino]-5-(2-oxopiperidin-3-yl)pent-2-enoate.
| Compound Name | ethyl (E)-4-[(3-aminonaphthalene-2-carbonyl)amino]-5-(2-oxopiperidin-3-yl)pent-2-enoate |
|---|---|
| PubChem CID | 142102634 |
| Molecular Formula | C23H27N3O4 |
| Molecular Weight | 409.49 g/mol |
| Exact Mass | 409.20 |
| IUPAC Name | ethyl (E)-4-[(3-aminonaphthalene-2-carbonyl)amino]-5-(2-oxopiperidin-3-yl)pent-2-enoate |
| SMILES | CCOC(=O)/C=C/C(CC1CCCNC1=O)NC(=O)c1cc2ccccc2cc1N |
| InChI | InChI=1S/C23H27N3O4/c1-2-30-21(27)10-9-18(12-17-8-5-11-25-22(17)28)26-23(29)19-13-15-6-3-4-7-16(15)14-20(19)24/h3-4,6-7,9-10,13-14,17-18H,2,5,8,11-12,24H2,1H3,(H,25,28)(H,26,29)/b10-9+ |
| InChIKey | HUVFMZOLFRWCBZ-MDZDMXLPSA-N |
| XLogP | 2.56 |
| TPSA | 110.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.49 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|