C21H25N3O5 — CID 142102646
ethyl (E)-4-[(5-methoxy-1H-indole-2-carbonyl)amino]-5-[(3S)-2-oxopyrrolidin-3-yl]pent-2-enoate (PubChem CID 142102646) has the molecular formula C21H25N3O5 and a molecular weight of 399.45 g/mol. Its IUPAC name is ethyl (E)-4-[(5-methoxy-1H-indole-2-carbonyl)amino]-5-[(3S)-2-oxopyrrolidin-3-yl]pent-2-enoate.
| Compound Name | ethyl (E)-4-[(5-methoxy-1H-indole-2-carbonyl)amino]-5-[(3S)-2-oxopyrrolidin-3-yl]pent-2-enoate |
|---|---|
| PubChem CID | 142102646 |
| Molecular Formula | C21H25N3O5 |
| Molecular Weight | 399.45 g/mol |
| Exact Mass | 399.18 |
| IUPAC Name | ethyl (E)-4-[(5-methoxy-1H-indole-2-carbonyl)amino]-5-[(3S)-2-oxopyrrolidin-3-yl]pent-2-enoate |
| SMILES | CCOC(=O)/C=C/C(C[C@@H]1CCNC1=O)NC(=O)c1cc2cc(OC)ccc2[nH]1 |
| InChI | InChI=1S/C21H25N3O5/c1-3-29-19(25)7-4-15(10-13-8-9-22-20(13)26)23-21(27)18-12-14-11-16(28-2)5-6-17(14)24-18/h4-7,11-13,15,24H,3,8-10H2,1-2H3,(H,22,26)(H,23,27)/b7-4+/t13-,15?/m0/s1 |
| InChIKey | VXUAGYYXTQFOHV-SYGJZSBJSA-N |
| XLogP | 1.92 |
| TPSA | 109.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.45 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|