C22H27N3O4 — CID 20595646
ethyl (E)-4-[(5-ethyl-1H-indole-2-carbonyl)amino]-5-(2-oxopyrrolidin-3-yl)pent-2-enoate (PubChem CID 20595646) has the molecular formula C22H27N3O4 and a molecular weight of 397.48 g/mol. Its IUPAC name is ethyl (E)-4-[(5-ethyl-1H-indole-2-carbonyl)amino]-5-(2-oxopyrrolidin-3-yl)pent-2-enoate.
| Compound Name | ethyl (E)-4-[(5-ethyl-1H-indole-2-carbonyl)amino]-5-(2-oxopyrrolidin-3-yl)pent-2-enoate |
|---|---|
| PubChem CID | 20595646 |
| Molecular Formula | C22H27N3O4 |
| Molecular Weight | 397.48 g/mol |
| Exact Mass | 397.20 |
| IUPAC Name | ethyl (E)-4-[(5-ethyl-1H-indole-2-carbonyl)amino]-5-(2-oxopyrrolidin-3-yl)pent-2-enoate |
| SMILES | CCOC(=O)/C=C/C(CC1CCNC1=O)NC(=O)c1cc2cc(CC)ccc2[nH]1 |
| InChI | InChI=1S/C22H27N3O4/c1-3-14-5-7-18-16(11-14)13-19(25-18)22(28)24-17(6-8-20(26)29-4-2)12-15-9-10-23-21(15)27/h5-8,11,13,15,17,25H,3-4,9-10,12H2,1-2H3,(H,23,27)(H,24,28)/b8-6+ |
| InChIKey | NCUTVESFPAXGMF-SOFGYWHQSA-N |
| XLogP | 2.47 |
| TPSA | 100.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.48 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|