C20H21BrN2O5 — CID 20595643
ethyl (E)-4-[(5-bromo-1-benzofuran-2-carbonyl)amino]-5-(2-oxopyrrolidin-3-yl)pent-2-enoate (PubChem CID 20595643) has the molecular formula C20H21BrN2O5 and a molecular weight of 449.30 g/mol. Its IUPAC name is ethyl (E)-4-[(5-bromo-1-benzofuran-2-carbonyl)amino]-5-(2-oxopyrrolidin-3-yl)pent-2-enoate.
| Compound Name | ethyl (E)-4-[(5-bromo-1-benzofuran-2-carbonyl)amino]-5-(2-oxopyrrolidin-3-yl)pent-2-enoate |
|---|---|
| PubChem CID | 20595643 |
| Molecular Formula | C20H21BrN2O5 |
| Molecular Weight | 449.30 g/mol |
| Exact Mass | 448.06 |
| IUPAC Name | ethyl (E)-4-[(5-bromo-1-benzofuran-2-carbonyl)amino]-5-(2-oxopyrrolidin-3-yl)pent-2-enoate |
| SMILES | CCOC(=O)/C=C/C(CC1CCNC1=O)NC(=O)c1cc2cc(Br)ccc2o1 |
| InChI | InChI=1S/C20H21BrN2O5/c1-2-27-18(24)6-4-15(10-12-7-8-22-19(12)25)23-20(26)17-11-13-9-14(21)3-5-16(13)28-17/h3-6,9,11-12,15H,2,7-8,10H2,1H3,(H,22,25)(H,23,26)/b6-4+ |
| InChIKey | CDTZGKDMBHFTQZ-GQCTYLIASA-N |
| XLogP | 2.94 |
| TPSA | 97.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.30 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|