C31H40N4O7 — CID 155470348
benzyl N-[3-(4-hydroxyphenyl)-1-[[(2S)-4-methyl-1-oxo-1-[[(2S)-1-oxo-4-(2-oxopyrrolidin-3-yl)butan-2-yl]amino]pentan-2-yl]amino]-1-oxopropan-2-yl]carbamate (PubChem CID 155470348) has the molecular formula C31H40N4O7 and a molecular weight of 580.68 g/mol. Its IUPAC name is benzyl N-[3-(4-hydroxyphenyl)-1-[[(2S)-4-methyl-1-oxo-1-[[(2S)-1-oxo-4-(2-oxopyrrolidin-3-yl)butan-2-yl]amino]pentan-2-yl]amino]-1-oxopropan-2-yl]carbamate.
| Compound Name | benzyl N-[3-(4-hydroxyphenyl)-1-[[(2S)-4-methyl-1-oxo-1-[[(2S)-1-oxo-4-(2-oxopyrrolidin-3-yl)butan-2-yl]amino]pentan-2-yl]amino]-1-oxopropan-2-yl]carbamate |
|---|---|
| PubChem CID | 155470348 |
| Molecular Formula | C31H40N4O7 |
| Molecular Weight | 580.68 g/mol |
| Exact Mass | 580.29 |
| IUPAC Name | benzyl N-[3-(4-hydroxyphenyl)-1-[[(2S)-4-methyl-1-oxo-1-[[(2S)-1-oxo-4-(2-oxopyrrolidin-3-yl)butan-2-yl]amino]pentan-2-yl]amino]-1-oxopropan-2-yl]carbamate |
| SMILES | CC(C)C[C@H](NC(=O)C(Cc1ccc(O)cc1)NC(=O)OCc1ccccc1)C(=O)N[C@H](C=O)CCC1CCNC1=O |
| InChI | InChI=1S/C31H40N4O7/c1-20(2)16-26(29(39)33-24(18-36)11-10-23-14-15-32-28(23)38)34-30(40)27(17-21-8-12-25(37)13-9-21)35-31(41)42-19-22-6-4-3-5-7-22/h3-9,12-13,18,20,23-24,26-27,37H,10-11,14-17,19H2,1-2H3,(H,32,38)(H,33,39)(H,34,40)(H,35,41)/t23?,24-,26-,27?/m0/s1 |
| InChIKey | PBZLYJRZIHFGQN-XYGNHZRLSA-N |
| XLogP | 2.36 |
| TPSA | 162.93 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.68 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|