C18H16O2 — CID 155470576
2,3-bis(but-2-ynoxy)naphthalene (PubChem CID 155470576) has the molecular formula C18H16O2 and a molecular weight of 264.32 g/mol. Its IUPAC name is 2,3-bis(but-2-ynoxy)naphthalene.
| Compound Name | 2,3-bis(but-2-ynoxy)naphthalene |
|---|---|
| PubChem CID | 155470576 |
| Molecular Formula | C18H16O2 |
| Molecular Weight | 264.32 g/mol |
| Exact Mass | 264.12 |
| IUPAC Name | 2,3-bis(but-2-ynoxy)naphthalene |
| SMILES | CC#CCOc1cc2ccccc2cc1OCC#CC |
| InChI | InChI=1S/C18H16O2/c1-3-5-11-19-17-13-15-9-7-8-10-16(15)14-18(17)20-12-6-4-2/h7-10,13-14H,11-12H2,1-2H3 |
| InChIKey | BSINGRRNSMHTBK-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.32 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|