C37H23N3O — CID 155473814
2-(3-naphtho[1,2-b][1]benzofuran-3-ylphenyl)-4,6-diphenyl-1,3,5-triazine (PubChem CID 155473814) has the molecular formula C37H23N3O and a molecular weight of 525.61 g/mol. Its IUPAC name is 2-(3-naphtho[1,2-b][1]benzofuran-3-ylphenyl)-4,6-diphenyl-1,3,5-triazine.
| Compound Name | 2-(3-naphtho[1,2-b][1]benzofuran-3-ylphenyl)-4,6-diphenyl-1,3,5-triazine |
|---|---|
| PubChem CID | 155473814 |
| Molecular Formula | C37H23N3O |
| Molecular Weight | 525.61 g/mol |
| Exact Mass | 525.18 |
| IUPAC Name | 2-(3-naphtho[1,2-b][1]benzofuran-3-ylphenyl)-4,6-diphenyl-1,3,5-triazine |
| SMILES | c1ccc(-c2nc(-c3ccccc3)nc(-c3cccc(-c4ccc5c(ccc6c7ccccc7oc56)c4)c3)n2)cc1 |
| InChI | InChI=1S/C37H23N3O/c1-3-10-24(11-4-1)35-38-36(25-12-5-2-6-13-25)40-37(39-35)29-15-9-14-26(23-29)27-18-20-30-28(22-27)19-21-32-31-16-7-8-17-33(31)41-34(30)32/h1-23H |
| InChIKey | GAUOMOVYQVRBLA-UHFFFAOYSA-N |
| XLogP | 9.59 |
| TPSA | 51.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.61 |
| LogP ≤ 5 | 9.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |