C22H26N11O12PS — CID 155476730
2-amino-9-[19-(6-aminopurin-9-yl)-4-hydroxy-20-methoxy-4,12,12-trioxo-3,5,8,13,16,18-hexaoxa-12λ6-thia-11-aza-4λ5-phosphatetracyclo[13.2.2.16,9.01,14]icosan-7-yl]-1H-purin-6-one (PubChem CID 155476730) has the molecular formula C22H26N11O12PS and a molecular weight of 699.56 g/mol. Its IUPAC name is 2-amino-9-[19-(6-aminopurin-9-yl)-4-hydroxy-20-methoxy-4,12,12-trioxo-3,5,8,13,16,18-hexaoxa-12λ6-thia-11-aza-4λ5-phosphatetracyclo[13.2.2.16,9.01,14]icosan-7-yl]-1H-purin-6-one.
| Compound Name | 2-amino-9-[19-(6-aminopurin-9-yl)-4-hydroxy-20-methoxy-4,12,12-trioxo-3,5,8,13,16,18-hexaoxa-12λ6-thia-11-aza-4λ5-phosphatetracyclo[13.2.2.16,9.01,14]icosan-7-yl]-1H-purin-6-one |
|---|---|
| PubChem CID | 155476730 |
| Molecular Formula | C22H26N11O12PS |
| Molecular Weight | 699.56 g/mol |
| Exact Mass | 699.12 |
| IUPAC Name | 2-amino-9-[19-(6-aminopurin-9-yl)-4-hydroxy-20-methoxy-4,12,12-trioxo-3,5,8,13,16,18-hexaoxa-12λ6-thia-11-aza-4λ5-phosphatetracyclo[13.2.2.16,9.01,14]icosan-7-yl]-1H-purin-6-one |
| SMILES | COC1C2CNS(=O)(=O)OC3C4OCC3(COP(=O)(O)OC1C(n1cnc3c(=O)[nH]c(N)nc31)O2)OC4n1cnc2c(N)ncnc21 |
| InChI | InChI=1S/C22H26N11O12PS/c1-39-11-8-2-29-47(37,38)45-14-13-20(32-6-27-9-15(23)25-5-26-16(9)32)43-22(14,3-40-13)4-41-46(35,36)44-12(11)19(42-8)33-7-28-10-17(33)30-21(24)31-18(10)34/h5-8,11-14,19-20,29H,2-4H2,1H3,(H,35,36)(H2,23,25,26)(H3,24,30,31,34) |
| InChIKey | SGONLRJYGNVWQD-UHFFFAOYSA-N |
| XLogP | -2.56 |
| TPSA | 307.29 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 20 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 699.56 |
| LogP ≤ 5 | -2.56 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 20 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|