C21H26N11O11PS — CID 155476788
2-amino-9-[8-(6-aminopurin-9-yl)-3-hydroxy-18-methoxy-3,12,12-trioxo-2,4,7,13,16-pentaoxa-12λ6-thia-11-aza-3λ5-phosphatricyclo[13.2.1.06,10]octadecan-17-yl]-1H-purin-6-one (PubChem CID 155476788) has the molecular formula C21H26N11O11PS and a molecular weight of 671.55 g/mol. Its IUPAC name is 2-amino-9-[8-(6-aminopurin-9-yl)-3-hydroxy-18-methoxy-3,12,12-trioxo-2,4,7,13,16-pentaoxa-12λ6-thia-11-aza-3λ5-phosphatricyclo[13.2.1.06,10]octadecan-17-yl]-1H-purin-6-one.
| Compound Name | 2-amino-9-[8-(6-aminopurin-9-yl)-3-hydroxy-18-methoxy-3,12,12-trioxo-2,4,7,13,16-pentaoxa-12λ6-thia-11-aza-3λ5-phosphatricyclo[13.2.1.06,10]octadecan-17-yl]-1H-purin-6-one |
|---|---|
| PubChem CID | 155476788 |
| Molecular Formula | C21H26N11O11PS |
| Molecular Weight | 671.55 g/mol |
| Exact Mass | 671.13 |
| IUPAC Name | 2-amino-9-[8-(6-aminopurin-9-yl)-3-hydroxy-18-methoxy-3,12,12-trioxo-2,4,7,13,16-pentaoxa-12λ6-thia-11-aza-3λ5-phosphatricyclo[13.2.1.06,10]octadecan-17-yl]-1H-purin-6-one |
| SMILES | COC1C2COS(=O)(=O)NC3CC(n4cnc5c(N)ncnc54)OC3COP(=O)(O)OC1C(n1cnc3c(=O)[nH]c(N)nc31)O2 |
| InChI | InChI=1S/C21H26N11O11PS/c1-38-14-10-4-40-45(36,37)30-8-2-11(31-6-26-12-16(22)24-5-25-17(12)31)41-9(8)3-39-44(34,35)43-15(14)20(42-10)32-7-27-13-18(32)28-21(23)29-19(13)33/h5-11,14-15,20,30H,2-4H2,1H3,(H,34,35)(H2,22,24,25)(H3,23,28,29,33) |
| InChIKey | PAJZIGBWAPQZRE-UHFFFAOYSA-N |
| XLogP | -1.94 |
| TPSA | 298.06 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 19 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 671.55 |
| LogP ≤ 5 | -1.94 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 19 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|