C21H24N6O2 — CID 155480043
N-[(3R)-5-methyl-3,4-dihydro-2H-1,5-benzoxazepin-3-yl]-5-pyrazol-1-yl-4,5,6,7-tetrahydro-1H-indazole-3-carboxamide (PubChem CID 155480043) has the molecular formula C21H24N6O2 and a molecular weight of 392.46 g/mol. Its IUPAC name is N-[(3R)-5-methyl-3,4-dihydro-2H-1,5-benzoxazepin-3-yl]-5-pyrazol-1-yl-4,5,6,7-tetrahydro-1H-indazole-3-carboxamide.
| Compound Name | N-[(3R)-5-methyl-3,4-dihydro-2H-1,5-benzoxazepin-3-yl]-5-pyrazol-1-yl-4,5,6,7-tetrahydro-1H-indazole-3-carboxamide |
|---|---|
| PubChem CID | 155480043 |
| Molecular Formula | C21H24N6O2 |
| Molecular Weight | 392.46 g/mol |
| Exact Mass | 392.20 |
| IUPAC Name | N-[(3R)-5-methyl-3,4-dihydro-2H-1,5-benzoxazepin-3-yl]-5-pyrazol-1-yl-4,5,6,7-tetrahydro-1H-indazole-3-carboxamide |
| SMILES | CN1C[C@@H](NC(=O)c2n[nH]c3c2CC(n2cccn2)CC3)COc2ccccc21 |
| InChI | InChI=1S/C21H24N6O2/c1-26-12-14(13-29-19-6-3-2-5-18(19)26)23-21(28)20-16-11-15(27-10-4-9-22-27)7-8-17(16)24-25-20/h2-6,9-10,14-15H,7-8,11-13H2,1H3,(H,23,28)(H,24,25)/t14-,15?/m1/s1 |
| InChIKey | JUEYDYJGEAEROL-GICMACPYSA-N |
| XLogP | 1.96 |
| TPSA | 88.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.46 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |