C20H25N3O — CID 25161464
N-cyclohexyl-5-phenyl-4,5,6,7-tetrahydro-1H-indazole-3-carboxamide (PubChem CID 25161464) has the molecular formula C20H25N3O and a molecular weight of 323.44 g/mol. Its IUPAC name is N-cyclohexyl-5-phenyl-4,5,6,7-tetrahydro-1H-indazole-3-carboxamide.
| Compound Name | N-cyclohexyl-5-phenyl-4,5,6,7-tetrahydro-1H-indazole-3-carboxamide |
|---|---|
| PubChem CID | 25161464 |
| Molecular Formula | C20H25N3O |
| Molecular Weight | 323.44 g/mol |
| Exact Mass | 323.20 |
| IUPAC Name | N-cyclohexyl-5-phenyl-4,5,6,7-tetrahydro-1H-indazole-3-carboxamide |
| SMILES | O=C(NC1CCCCC1)c1n[nH]c2c1CC(c1ccccc1)CC2 |
| InChI | InChI=1S/C20H25N3O/c24-20(21-16-9-5-2-6-10-16)19-17-13-15(11-12-18(17)22-23-19)14-7-3-1-4-8-14/h1,3-4,7-8,15-16H,2,5-6,9-13H2,(H,21,24)(H,22,23) |
| InChIKey | SSKHPVNGTNMXFG-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 57.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.44 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |