C16H27N3 — CID 155480460
2-heptyl-4-methyl-5-methylidene-7,8-dihydro-6H-pyrazolo[1,5-a][1,3]diazepine (PubChem CID 155480460) has the molecular formula C16H27N3 and a molecular weight of 261.41 g/mol. Its IUPAC name is 2-heptyl-4-methyl-5-methylidene-7,8-dihydro-6H-pyrazolo[1,5-a][1,3]diazepine.
| Compound Name | 2-heptyl-4-methyl-5-methylidene-7,8-dihydro-6H-pyrazolo[1,5-a][1,3]diazepine |
|---|---|
| PubChem CID | 155480460 |
| Molecular Formula | C16H27N3 |
| Molecular Weight | 261.41 g/mol |
| Exact Mass | 261.22 |
| IUPAC Name | 2-heptyl-4-methyl-5-methylidene-7,8-dihydro-6H-pyrazolo[1,5-a][1,3]diazepine |
| SMILES | C=C1CCCn2nc(CCCCCCC)cc2N1C |
| InChI | InChI=1S/C16H27N3/c1-4-5-6-7-8-11-15-13-16-18(3)14(2)10-9-12-19(16)17-15/h13H,2,4-12H2,1,3H3 |
| InChIKey | OIGQSHQGDOTBOY-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 21.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.41 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|