About 6-pentyl-2,3-dihydro-1H-pyrrolizine
6-pentyl-2,3-dihydro-1H-pyrrolizine (PubChem CID 15720827) has the molecular formula C12H19N
and a molecular weight of 177.29 g/mol. Its IUPAC name is 6-pentyl-2,3-dihydro-1H-pyrrolizine.
Molecular Properties
| Compound Name | 6-pentyl-2,3-dihydro-1H-pyrrolizine |
| PubChem CID | 15720827 |
| Molecular Formula | C12H19N |
| Molecular Weight | 177.29 g/mol |
| Exact Mass | 177.15 |
| IUPAC Name | 6-pentyl-2,3-dihydro-1H-pyrrolizine |
| SMILES | CCCCCc1cc2n(c1)CCC2 |
| InChI | InChI=1S/C12H19N/c1-2-3-4-6-11-9-12-7-5-8-13(12)10-11/h9-10H,2-8H2,1H3 |
| InChIKey | SPPHTRZTBRIVFP-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 4.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 177.29 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 6-pentyl-2,3-dihydro-1H-pyrrolizine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-pentyl-2,3-dihydro-1H-pyrrolizine?
The IUPAC name of 6-pentyl-2,3-dihydro-1H-pyrrolizine (CID 15720827) is 6-pentyl-2,3-dihydro-1H-pyrrolizine.
What is the SMILES notation for 6-pentyl-2,3-dihydro-1H-pyrrolizine?
The canonical SMILES for 6-pentyl-2,3-dihydro-1H-pyrrolizine is CCCCCc1cc2n(c1)CCC2.
What is the InChIKey of 6-pentyl-2,3-dihydro-1H-pyrrolizine?
The InChIKey is SPPHTRZTBRIVFP-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H19N/c1-2-3-4-6-11-9-12-7-5-8-13(12)10-11/h9-10H,2-8H2,1H3.
What are the key properties of 6-pentyl-2,3-dihydro-1H-pyrrolizine?
6-pentyl-2,3-dihydro-1H-pyrrolizine has a molecular weight of 177.29 g/mol, XLogP of 3.17, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 6-pentyl-2,3-dihydro-1H-pyrrolizine is sourced from PubChem (CID 15720827), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).