C22H26ClFN4O3 — CID 155481581
(E)-N-[1-(4-chloro-3-fluorophenyl)-2-hydroxyethyl]-N-methyl-3-[2-(oxan-4-ylamino)pyrimidin-4-yl]but-2-enamide (PubChem CID 155481581) has the molecular formula C22H26ClFN4O3 and a molecular weight of 448.93 g/mol. Its IUPAC name is (E)-N-[1-(4-chloro-3-fluorophenyl)-2-hydroxyethyl]-N-methyl-3-[2-(oxan-4-ylamino)pyrimidin-4-yl]but-2-enamide.
| Compound Name | (E)-N-[1-(4-chloro-3-fluorophenyl)-2-hydroxyethyl]-N-methyl-3-[2-(oxan-4-ylamino)pyrimidin-4-yl]but-2-enamide |
|---|---|
| PubChem CID | 155481581 |
| Molecular Formula | C22H26ClFN4O3 |
| Molecular Weight | 448.93 g/mol |
| Exact Mass | 448.17 |
| IUPAC Name | (E)-N-[1-(4-chloro-3-fluorophenyl)-2-hydroxyethyl]-N-methyl-3-[2-(oxan-4-ylamino)pyrimidin-4-yl]but-2-enamide |
| SMILES | C/C(=C\C(=O)N(C)C(CO)c1ccc(Cl)c(F)c1)c1ccnc(NC2CCOCC2)n1 |
| InChI | InChI=1S/C22H26ClFN4O3/c1-14(19-5-8-25-22(27-19)26-16-6-9-31-10-7-16)11-21(30)28(2)20(13-29)15-3-4-17(23)18(24)12-15/h3-5,8,11-12,16,20,29H,6-7,9-10,13H2,1-2H3,(H,25,26,27)/b14-11+ |
| InChIKey | JHEJMIFSAPYRKB-SDNWHVSQSA-N |
| XLogP | 3.46 |
| TPSA | 87.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.93 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|