C20H13FN4O2 — CID 155481978
3-cyano-2-fluoro-N-[3-(furan-3-yl)-1H-indazol-5-yl]-6-methylbenzamide (PubChem CID 155481978) has the molecular formula C20H13FN4O2 and a molecular weight of 360.35 g/mol. Its IUPAC name is 3-cyano-2-fluoro-N-[3-(furan-3-yl)-1H-indazol-5-yl]-6-methylbenzamide.
| Compound Name | 3-cyano-2-fluoro-N-[3-(furan-3-yl)-1H-indazol-5-yl]-6-methylbenzamide |
|---|---|
| PubChem CID | 155481978 |
| Molecular Formula | C20H13FN4O2 |
| Molecular Weight | 360.35 g/mol |
| Exact Mass | 360.10 |
| IUPAC Name | 3-cyano-2-fluoro-N-[3-(furan-3-yl)-1H-indazol-5-yl]-6-methylbenzamide |
| SMILES | Cc1ccc(C#N)c(F)c1C(=O)Nc1ccc2[nH]nc(-c3ccoc3)c2c1 |
| InChI | InChI=1S/C20H13FN4O2/c1-11-2-3-12(9-22)18(21)17(11)20(26)23-14-4-5-16-15(8-14)19(25-24-16)13-6-7-27-10-13/h2-8,10H,1H3,(H,23,26)(H,24,25) |
| InChIKey | LYHUQSHBDYMHGA-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 94.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.35 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |