C20H11F2N3O2 — CID 167625204
3-cyano-2,6-difluoro-N-[3-(furan-3-yl)-1H-isoindol-5-yl]benzamide (PubChem CID 167625204) has the molecular formula C20H11F2N3O2 and a molecular weight of 363.32 g/mol. Its IUPAC name is 3-cyano-2,6-difluoro-N-[3-(furan-3-yl)-1H-isoindol-5-yl]benzamide.
| Compound Name | 3-cyano-2,6-difluoro-N-[3-(furan-3-yl)-1H-isoindol-5-yl]benzamide |
|---|---|
| PubChem CID | 167625204 |
| Molecular Formula | C20H11F2N3O2 |
| Molecular Weight | 363.32 g/mol |
| Exact Mass | 363.08 |
| IUPAC Name | 3-cyano-2,6-difluoro-N-[3-(furan-3-yl)-1H-isoindol-5-yl]benzamide |
| SMILES | N#Cc1ccc(F)c(C(=O)Nc2ccc3c(c2)C(c2ccoc2)=NC3)c1F |
| InChI | InChI=1S/C20H11F2N3O2/c21-16-4-2-11(8-23)18(22)17(16)20(26)25-14-3-1-12-9-24-19(15(12)7-14)13-5-6-27-10-13/h1-7,10H,9H2,(H,25,26) |
| InChIKey | MZUAUZKYGCNLGM-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 78.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.32 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |