C18H13N5O2 — CID 167537423
3-cyano-N-[3-(furan-3-yl)-1H-isoindol-5-yl]-4-methyl-1H-pyrazole-5-carboxamide (PubChem CID 167537423) has the molecular formula C18H13N5O2 and a molecular weight of 331.34 g/mol. Its IUPAC name is 3-cyano-N-[3-(furan-3-yl)-1H-isoindol-5-yl]-4-methyl-1H-pyrazole-5-carboxamide.
| Compound Name | 3-cyano-N-[3-(furan-3-yl)-1H-isoindol-5-yl]-4-methyl-1H-pyrazole-5-carboxamide |
|---|---|
| PubChem CID | 167537423 |
| Molecular Formula | C18H13N5O2 |
| Molecular Weight | 331.34 g/mol |
| Exact Mass | 331.11 |
| IUPAC Name | 3-cyano-N-[3-(furan-3-yl)-1H-isoindol-5-yl]-4-methyl-1H-pyrazole-5-carboxamide |
| SMILES | Cc1c(C#N)n[nH]c1C(=O)Nc1ccc2c(c1)C(c1ccoc1)=NC2 |
| InChI | InChI=1S/C18H13N5O2/c1-10-15(7-19)22-23-16(10)18(24)21-13-3-2-11-8-20-17(14(11)6-13)12-4-5-25-9-12/h2-6,9H,8H2,1H3,(H,21,24)(H,22,23) |
| InChIKey | ASQUEIMOCUOHNW-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 107.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.34 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |