C18H14ClN5O2 — CID 155482519
2-chloro-3-ethyl-N-[3-(1,3-oxazol-5-yl)-1H-indazol-5-yl]pyridine-4-carboxamide (PubChem CID 155482519) has the molecular formula C18H14ClN5O2 and a molecular weight of 367.80 g/mol. Its IUPAC name is 2-chloro-3-ethyl-N-[3-(1,3-oxazol-5-yl)-1H-indazol-5-yl]pyridine-4-carboxamide.
| Compound Name | 2-chloro-3-ethyl-N-[3-(1,3-oxazol-5-yl)-1H-indazol-5-yl]pyridine-4-carboxamide |
|---|---|
| PubChem CID | 155482519 |
| Molecular Formula | C18H14ClN5O2 |
| Molecular Weight | 367.80 g/mol |
| Exact Mass | 367.08 |
| IUPAC Name | 2-chloro-3-ethyl-N-[3-(1,3-oxazol-5-yl)-1H-indazol-5-yl]pyridine-4-carboxamide |
| SMILES | CCc1c(C(=O)Nc2ccc3[nH]nc(-c4cnco4)c3c2)ccnc1Cl |
| InChI | InChI=1S/C18H14ClN5O2/c1-2-11-12(5-6-21-17(11)19)18(25)22-10-3-4-14-13(7-10)16(24-23-14)15-8-20-9-26-15/h3-9H,2H2,1H3,(H,22,25)(H,23,24) |
| InChIKey | HXJKWSMFBVAULT-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 96.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.80 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|