C39H36N2 — CID 155483123
5-cyclohexa-1,5-dien-1-yl-11-(9,9-dimethyl-1,2-dihydrofluoren-2-yl)-4a,5a,6,12b-tetrahydroindolo[3,2-b]carbazole (PubChem CID 155483123) has the molecular formula C39H36N2 and a molecular weight of 532.73 g/mol. Its IUPAC name is 5-cyclohexa-1,5-dien-1-yl-11-(9,9-dimethyl-1,2-dihydrofluoren-2-yl)-4a,5a,6,12b-tetrahydroindolo[3,2-b]carbazole.
| Compound Name | 5-cyclohexa-1,5-dien-1-yl-11-(9,9-dimethyl-1,2-dihydrofluoren-2-yl)-4a,5a,6,12b-tetrahydroindolo[3,2-b]carbazole |
|---|---|
| PubChem CID | 155483123 |
| Molecular Formula | C39H36N2 |
| Molecular Weight | 532.73 g/mol |
| Exact Mass | 532.29 |
| IUPAC Name | 5-cyclohexa-1,5-dien-1-yl-11-(9,9-dimethyl-1,2-dihydrofluoren-2-yl)-4a,5a,6,12b-tetrahydroindolo[3,2-b]carbazole |
| SMILES | CC1(C)C2=C(C=CC(n3c4c(c5ccccc53)CC3C(=C4)C4C=CC=CC4N3C3=CCCC=C3)C2)c2ccccc21 |
| InChI | InChI=1S/C39H36N2/c1-39(2)33-17-9-6-14-27(33)28-21-20-26(22-34(28)39)41-36-19-11-8-16-30(36)32-23-37-31(24-38(32)41)29-15-7-10-18-35(29)40(37)25-12-4-3-5-13-25/h4,6-21,24,26,29,35,37H,3,5,22-23H2,1-2H3 |
| InChIKey | RAVWZHPKGWAEIJ-UHFFFAOYSA-N |
| XLogP | 8.86 |
| TPSA | 8.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.73 |
| LogP ≤ 5 | 8.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |