C48H41N5 — CID 147988073
5-[6-(9-cyclohexa-1,5-dien-1-yl-3,4,5,6-tetrahydrocarbazol-3-yl)-4-phenyl-1,4-dihydro-1,3,5-triazin-2-yl]-7,7-dimethylindeno[2,1-b]carbazole (PubChem CID 147988073) has the molecular formula C48H41N5 and a molecular weight of 687.89 g/mol. Its IUPAC name is 5-[6-(9-cyclohexa-1,5-dien-1-yl-3,4,5,6-tetrahydrocarbazol-3-yl)-4-phenyl-1,4-dihydro-1,3,5-triazin-2-yl]-7,7-dimethylindeno[2,1-b]carbazole.
| Compound Name | 5-[6-(9-cyclohexa-1,5-dien-1-yl-3,4,5,6-tetrahydrocarbazol-3-yl)-4-phenyl-1,4-dihydro-1,3,5-triazin-2-yl]-7,7-dimethylindeno[2,1-b]carbazole |
|---|---|
| PubChem CID | 147988073 |
| Molecular Formula | C48H41N5 |
| Molecular Weight | 687.89 g/mol |
| Exact Mass | 687.34 |
| IUPAC Name | 5-[6-(9-cyclohexa-1,5-dien-1-yl-3,4,5,6-tetrahydrocarbazol-3-yl)-4-phenyl-1,4-dihydro-1,3,5-triazin-2-yl]-7,7-dimethylindeno[2,1-b]carbazole |
| SMILES | CC1(C)c2ccccc2-c2cc3c4ccccc4n(C4=NC(c5ccccc5)N=C(C5C=Cc6c(c7c(n6C6=CCCC=C6)C=CCC7)C5)N4)c3cc21 |
| InChI | InChI=1S/C48H41N5/c1-48(2)39-22-12-9-19-33(39)36-28-38-35-21-11-14-24-42(35)53(44(38)29-40(36)48)47-50-45(30-15-5-3-6-16-30)49-46(51-47)31-25-26-43-37(27-31)34-20-10-13-23-41(34)52(43)32-17-7-4-8-18-32/h3,5-7,9,11-19,21-26,28-29,31,45H,4,8,10,20,27H2,1-2H3,(H,49,50,51) |
| InChIKey | IUNAUBRGWQQLPW-UHFFFAOYSA-N |
| XLogP | 10.84 |
| TPSA | 46.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 687.89 |
| LogP ≤ 5 | 10.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |