C44H39N3 — CID 174366882
N-(9,9-dimethylfluoren-2-yl)-N-[4-(9-phenyl-3,4,5,6-tetrahydrocarbazol-3-yl)phenyl]-1,2-dihydropyridin-6-amine (PubChem CID 174366882) has the molecular formula C44H39N3 and a molecular weight of 609.82 g/mol. Its IUPAC name is N-(9,9-dimethylfluoren-2-yl)-N-[4-(9-phenyl-3,4,5,6-tetrahydrocarbazol-3-yl)phenyl]-1,2-dihydropyridin-6-amine.
| Compound Name | N-(9,9-dimethylfluoren-2-yl)-N-[4-(9-phenyl-3,4,5,6-tetrahydrocarbazol-3-yl)phenyl]-1,2-dihydropyridin-6-amine |
|---|---|
| PubChem CID | 174366882 |
| Molecular Formula | C44H39N3 |
| Molecular Weight | 609.82 g/mol |
| Exact Mass | 609.31 |
| IUPAC Name | N-(9,9-dimethylfluoren-2-yl)-N-[4-(9-phenyl-3,4,5,6-tetrahydrocarbazol-3-yl)phenyl]-1,2-dihydropyridin-6-amine |
| SMILES | CC1(C)c2ccccc2-c2ccc(N(C3=CC=CCN3)c3ccc(C4C=Cc5c(c6c(n5-c5ccccc5)C=CCC6)C4)cc3)cc21 |
| InChI | InChI=1S/C44H39N3/c1-44(2)39-16-8-6-14-35(39)36-25-24-34(29-40(36)44)46(43-18-10-11-27-45-43)33-22-19-30(20-23-33)31-21-26-42-38(28-31)37-15-7-9-17-41(37)47(42)32-12-4-3-5-13-32/h3-6,8-14,16-26,29,31,45H,7,15,27-28H2,1-2H3 |
| InChIKey | KXPVTMSCVNUFNN-UHFFFAOYSA-N |
| XLogP | 10.23 |
| TPSA | 20.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 609.82 |
| LogP ≤ 5 | 10.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |