C16H13BrF3N — CID 155490362
N-(4-bromo-2-methylphenyl)-2,2,2-trifluoro-1-(4-methylphenyl)ethanimine (PubChem CID 155490362) has the molecular formula C16H13BrF3N and a molecular weight of 356.19 g/mol. Its IUPAC name is N-(4-bromo-2-methylphenyl)-2,2,2-trifluoro-1-(4-methylphenyl)ethanimine.
| Compound Name | N-(4-bromo-2-methylphenyl)-2,2,2-trifluoro-1-(4-methylphenyl)ethanimine |
|---|---|
| PubChem CID | 155490362 |
| Molecular Formula | C16H13BrF3N |
| Molecular Weight | 356.19 g/mol |
| Exact Mass | 355.02 |
| IUPAC Name | N-(4-bromo-2-methylphenyl)-2,2,2-trifluoro-1-(4-methylphenyl)ethanimine |
| SMILES | Cc1ccc(/C(=N/c2ccc(Br)cc2C)C(F)(F)F)cc1 |
| InChI | InChI=1S/C16H13BrF3N/c1-10-3-5-12(6-4-10)15(16(18,19)20)21-14-8-7-13(17)9-11(14)2/h3-9H,1-2H3/b21-15- |
| InChIKey | UTZANJYPCDELPZ-QNGOZBTKSA-N |
| XLogP | 5.75 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.19 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|