C19H26FN3O3 — CID 155491870
N-[(3S,7S,8aS)-3-[2-(dimethylamino)-2-oxoethyl]-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-7-yl]-4-fluoro-2-methylbenzamide (PubChem CID 155491870) has the molecular formula C19H26FN3O3 and a molecular weight of 363.43 g/mol. Its IUPAC name is N-[(3S,7S,8aS)-3-[2-(dimethylamino)-2-oxoethyl]-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-7-yl]-4-fluoro-2-methylbenzamide.
| Compound Name | N-[(3S,7S,8aS)-3-[2-(dimethylamino)-2-oxoethyl]-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-7-yl]-4-fluoro-2-methylbenzamide |
|---|---|
| PubChem CID | 155491870 |
| Molecular Formula | C19H26FN3O3 |
| Molecular Weight | 363.43 g/mol |
| Exact Mass | 363.20 |
| IUPAC Name | N-[(3S,7S,8aS)-3-[2-(dimethylamino)-2-oxoethyl]-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-7-yl]-4-fluoro-2-methylbenzamide |
| SMILES | Cc1cc(F)ccc1C(=O)N[C@H]1C[C@H]2CO[C@@H](CC(=O)N(C)C)CN2C1 |
| InChI | InChI=1S/C19H26FN3O3/c1-12-6-13(20)4-5-17(12)19(25)21-14-7-15-11-26-16(10-23(15)9-14)8-18(24)22(2)3/h4-6,14-16H,7-11H2,1-3H3,(H,21,25)/t14-,15-,16-/m0/s1 |
| InChIKey | YUWWKBCDEBVHJK-JYJNAYRXSA-N |
| XLogP | 1.18 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.43 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |