C21H26FN5O3 — CID 155500145
N-[(3S,7S,8aS)-3-[2-(dimethylamino)-2-oxoethyl]-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-7-yl]-5-(3-fluorophenyl)-1H-pyrazole-4-carboxamide (PubChem CID 155500145) has the molecular formula C21H26FN5O3 and a molecular weight of 415.47 g/mol. Its IUPAC name is N-[(3S,7S,8aS)-3-[2-(dimethylamino)-2-oxoethyl]-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-7-yl]-5-(3-fluorophenyl)-1H-pyrazole-4-carboxamide.
| Compound Name | N-[(3S,7S,8aS)-3-[2-(dimethylamino)-2-oxoethyl]-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-7-yl]-5-(3-fluorophenyl)-1H-pyrazole-4-carboxamide |
|---|---|
| PubChem CID | 155500145 |
| Molecular Formula | C21H26FN5O3 |
| Molecular Weight | 415.47 g/mol |
| Exact Mass | 415.20 |
| IUPAC Name | N-[(3S,7S,8aS)-3-[2-(dimethylamino)-2-oxoethyl]-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-7-yl]-5-(3-fluorophenyl)-1H-pyrazole-4-carboxamide |
| SMILES | CN(C)C(=O)C[C@H]1CN2C[C@@H](NC(=O)c3cn[nH]c3-c3cccc(F)c3)C[C@H]2CO1 |
| InChI | InChI=1S/C21H26FN5O3/c1-26(2)19(28)8-17-11-27-10-15(7-16(27)12-30-17)24-21(29)18-9-23-25-20(18)13-4-3-5-14(22)6-13/h3-6,9,15-17H,7-8,10-12H2,1-2H3,(H,23,25)(H,24,29)/t15-,16-,17-/m0/s1 |
| InChIKey | BVPNKULCUMKHHS-ULQDDVLXSA-N |
| XLogP | 1.27 |
| TPSA | 90.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.47 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |