C16H20FN3OS — CID 74235548
N-(2-tert-butylsulfanylethyl)-5-(3-fluorophenyl)-1H-pyrazole-4-carboxamide (PubChem CID 74235548) has the molecular formula C16H20FN3OS and a molecular weight of 321.42 g/mol. Its IUPAC name is N-(2-tert-butylsulfanylethyl)-5-(3-fluorophenyl)-1H-pyrazole-4-carboxamide.
| Compound Name | N-(2-tert-butylsulfanylethyl)-5-(3-fluorophenyl)-1H-pyrazole-4-carboxamide |
|---|---|
| PubChem CID | 74235548 |
| Molecular Formula | C16H20FN3OS |
| Molecular Weight | 321.42 g/mol |
| Exact Mass | 321.13 |
| IUPAC Name | N-(2-tert-butylsulfanylethyl)-5-(3-fluorophenyl)-1H-pyrazole-4-carboxamide |
| SMILES | CC(C)(C)SCCNC(=O)c1cn[nH]c1-c1cccc(F)c1 |
| InChI | InChI=1S/C16H20FN3OS/c1-16(2,3)22-8-7-18-15(21)13-10-19-20-14(13)11-5-4-6-12(17)9-11/h4-6,9-10H,7-8H2,1-3H3,(H,18,21)(H,19,20) |
| InChIKey | QVZINLOZTXTZGG-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 57.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.42 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|