C20H26N4O4 — CID 155494407
N-[(3S,7R,8aS)-3-(2-hydroxyethyl)-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-7-yl]-3-(4-oxoquinazolin-3-yl)propanamide (PubChem CID 155494407) has the molecular formula C20H26N4O4 and a molecular weight of 386.45 g/mol. Its IUPAC name is N-[(3S,7R,8aS)-3-(2-hydroxyethyl)-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-7-yl]-3-(4-oxoquinazolin-3-yl)propanamide.
| Compound Name | N-[(3S,7R,8aS)-3-(2-hydroxyethyl)-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-7-yl]-3-(4-oxoquinazolin-3-yl)propanamide |
|---|---|
| PubChem CID | 155494407 |
| Molecular Formula | C20H26N4O4 |
| Molecular Weight | 386.45 g/mol |
| Exact Mass | 386.20 |
| IUPAC Name | N-[(3S,7R,8aS)-3-(2-hydroxyethyl)-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-7-yl]-3-(4-oxoquinazolin-3-yl)propanamide |
| SMILES | O=C(CCn1cnc2ccccc2c1=O)N[C@@H]1C[C@H]2CO[C@@H](CCO)CN2C1 |
| InChI | InChI=1S/C20H26N4O4/c25-8-6-16-11-24-10-14(9-15(24)12-28-16)22-19(26)5-7-23-13-21-18-4-2-1-3-17(18)20(23)27/h1-4,13-16,25H,5-12H2,(H,22,26)/t14-,15+,16+/m1/s1 |
| InChIKey | IIQVSSPTOMNDRB-PMPSAXMXSA-N |
| XLogP | 0.13 |
| TPSA | 96.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.45 |
| LogP ≤ 5 | 0.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |