C14H24N6O3 — CID 155496961
N-[(3S,7S,8aS)-3-(2-hydroxyethyl)-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-7-yl]-3-(5-methyltetrazol-1-yl)propanamide (PubChem CID 155496961) has the molecular formula C14H24N6O3 and a molecular weight of 324.39 g/mol. Its IUPAC name is N-[(3S,7S,8aS)-3-(2-hydroxyethyl)-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-7-yl]-3-(5-methyltetrazol-1-yl)propanamide.
| Compound Name | N-[(3S,7S,8aS)-3-(2-hydroxyethyl)-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-7-yl]-3-(5-methyltetrazol-1-yl)propanamide |
|---|---|
| PubChem CID | 155496961 |
| Molecular Formula | C14H24N6O3 |
| Molecular Weight | 324.39 g/mol |
| Exact Mass | 324.19 |
| IUPAC Name | N-[(3S,7S,8aS)-3-(2-hydroxyethyl)-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-7-yl]-3-(5-methyltetrazol-1-yl)propanamide |
| SMILES | Cc1nnnn1CCC(=O)N[C@H]1C[C@H]2CO[C@@H](CCO)CN2C1 |
| InChI | InChI=1S/C14H24N6O3/c1-10-16-17-18-20(10)4-2-14(22)15-11-6-12-9-23-13(3-5-21)8-19(12)7-11/h11-13,21H,2-9H2,1H3,(H,15,22)/t11-,12-,13-/m0/s1 |
| InChIKey | GVLKMMLSTNQUQT-AVGNSLFASA-N |
| XLogP | -1.29 |
| TPSA | 105.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.39 |
| LogP ≤ 5 | -1.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |