C17H26N4O2 — CID 155498809
N-[(3S,7S,8aS)-3-cyclopropyl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-7-yl]-3-(5-methylpyrazol-1-yl)propanamide (PubChem CID 155498809) has the molecular formula C17H26N4O2 and a molecular weight of 318.42 g/mol. Its IUPAC name is N-[(3S,7S,8aS)-3-cyclopropyl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-7-yl]-3-(5-methylpyrazol-1-yl)propanamide.
| Compound Name | N-[(3S,7S,8aS)-3-cyclopropyl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-7-yl]-3-(5-methylpyrazol-1-yl)propanamide |
|---|---|
| PubChem CID | 155498809 |
| Molecular Formula | C17H26N4O2 |
| Molecular Weight | 318.42 g/mol |
| Exact Mass | 318.21 |
| IUPAC Name | N-[(3S,7S,8aS)-3-cyclopropyl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-7-yl]-3-(5-methylpyrazol-1-yl)propanamide |
| SMILES | Cc1ccnn1CCC(=O)N[C@H]1C[C@H]2CO[C@@H](C3CC3)CN2C1 |
| InChI | InChI=1S/C17H26N4O2/c1-12-4-6-18-21(12)7-5-17(22)19-14-8-15-11-23-16(13-2-3-13)10-20(15)9-14/h4,6,13-16H,2-3,5,7-11H2,1H3,(H,19,22)/t14-,15-,16+/m0/s1 |
| InChIKey | DOIOGPGFZOIVLI-HRCADAONSA-N |
| XLogP | 0.95 |
| TPSA | 59.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.42 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |