C14H24N6O4 — CID 155972821
N-[(3S,7R,8aS)-3-methyl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-7-yl]-3-(5-methyltetrazol-1-yl)propanamide;formic acid (PubChem CID 155972821) has the molecular formula C14H24N6O4 and a molecular weight of 340.38 g/mol. Its IUPAC name is N-[(3S,7R,8aS)-3-methyl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-7-yl]-3-(5-methyltetrazol-1-yl)propanamide;formic acid.
| Compound Name | N-[(3S,7R,8aS)-3-methyl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-7-yl]-3-(5-methyltetrazol-1-yl)propanamide;formic acid |
|---|---|
| PubChem CID | 155972821 |
| Molecular Formula | C14H24N6O4 |
| Molecular Weight | 340.38 g/mol |
| Exact Mass | 340.19 |
| IUPAC Name | N-[(3S,7R,8aS)-3-methyl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-7-yl]-3-(5-methyltetrazol-1-yl)propanamide;formic acid |
| SMILES | Cc1nnnn1CCC(=O)N[C@@H]1C[C@H]2CO[C@@H](C)CN2C1.O=CO |
| InChI | InChI=1S/C13H22N6O2.CH2O2/c1-9-6-18-7-11(5-12(18)8-21-9)14-13(20)3-4-19-10(2)15-16-17-19;2-1-3/h9,11-12H,3-8H2,1-2H3,(H,14,20);1H,(H,2,3)/t9-,11+,12-;/m0./s1 |
| InChIKey | VLOIHZTUVBDOSG-CRGLIXAISA-N |
| XLogP | -0.95 |
| TPSA | 122.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.38 |
| LogP ≤ 5 | -0.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|