C14H22N4O2 — CID 154823115
N-[(3S,7R,8aS)-3-methyl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-7-yl]-2-(3-methylpyrazol-1-yl)acetamide (PubChem CID 154823115) has the molecular formula C14H22N4O2 and a molecular weight of 278.36 g/mol. Its IUPAC name is N-[(3S,7R,8aS)-3-methyl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-7-yl]-2-(3-methylpyrazol-1-yl)acetamide.
| Compound Name | N-[(3S,7R,8aS)-3-methyl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-7-yl]-2-(3-methylpyrazol-1-yl)acetamide |
|---|---|
| PubChem CID | 154823115 |
| Molecular Formula | C14H22N4O2 |
| Molecular Weight | 278.36 g/mol |
| Exact Mass | 278.17 |
| IUPAC Name | N-[(3S,7R,8aS)-3-methyl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-7-yl]-2-(3-methylpyrazol-1-yl)acetamide |
| SMILES | Cc1ccn(CC(=O)N[C@@H]2C[C@H]3CO[C@@H](C)CN3C2)n1 |
| InChI | InChI=1S/C14H22N4O2/c1-10-3-4-18(16-10)8-14(19)15-12-5-13-9-20-11(2)6-17(13)7-12/h3-4,11-13H,5-9H2,1-2H3,(H,15,19)/t11-,12+,13-/m0/s1 |
| InChIKey | VEFFTRHPLFOGRA-XQQFMLRXSA-N |
| XLogP | 0.17 |
| TPSA | 59.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.36 |
| LogP ≤ 5 | 0.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |