C22H30N4O4 — CID 155500308
N-[(3S,7R,8aS)-3-(2-hydroxyethyl)-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-7-yl]-4-[3-(3-methylphenyl)-1,2,4-oxadiazol-5-yl]butanamide (PubChem CID 155500308) has the molecular formula C22H30N4O4 and a molecular weight of 414.51 g/mol. Its IUPAC name is N-[(3S,7R,8aS)-3-(2-hydroxyethyl)-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-7-yl]-4-[3-(3-methylphenyl)-1,2,4-oxadiazol-5-yl]butanamide.
| Compound Name | N-[(3S,7R,8aS)-3-(2-hydroxyethyl)-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-7-yl]-4-[3-(3-methylphenyl)-1,2,4-oxadiazol-5-yl]butanamide |
|---|---|
| PubChem CID | 155500308 |
| Molecular Formula | C22H30N4O4 |
| Molecular Weight | 414.51 g/mol |
| Exact Mass | 414.23 |
| IUPAC Name | N-[(3S,7R,8aS)-3-(2-hydroxyethyl)-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-7-yl]-4-[3-(3-methylphenyl)-1,2,4-oxadiazol-5-yl]butanamide |
| SMILES | Cc1cccc(-c2noc(CCCC(=O)N[C@@H]3C[C@H]4CO[C@@H](CCO)CN4C3)n2)c1 |
| InChI | InChI=1S/C22H30N4O4/c1-15-4-2-5-16(10-15)22-24-21(30-25-22)7-3-6-20(28)23-17-11-18-14-29-19(8-9-27)13-26(18)12-17/h2,4-5,10,17-19,27H,3,6-9,11-14H2,1H3,(H,23,28)/t17-,18+,19+/m1/s1 |
| InChIKey | UGQMEHGXHJDWGY-QYZOEREBSA-N |
| XLogP | 1.71 |
| TPSA | 100.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.51 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |