C21H30N2O5 — CID 155496022
1-[3-[(3S,4R)-4-hydroxy-3-(hydroxymethyl)-3-(3-methoxypropyl)piperidine-1-carbonyl]phenyl]pyrrolidin-2-one (PubChem CID 155496022) has the molecular formula C21H30N2O5 and a molecular weight of 390.48 g/mol. Its IUPAC name is 1-[3-[(3S,4R)-4-hydroxy-3-(hydroxymethyl)-3-(3-methoxypropyl)piperidine-1-carbonyl]phenyl]pyrrolidin-2-one.
| Compound Name | 1-[3-[(3S,4R)-4-hydroxy-3-(hydroxymethyl)-3-(3-methoxypropyl)piperidine-1-carbonyl]phenyl]pyrrolidin-2-one |
|---|---|
| PubChem CID | 155496022 |
| Molecular Formula | C21H30N2O5 |
| Molecular Weight | 390.48 g/mol |
| Exact Mass | 390.22 |
| IUPAC Name | 1-[3-[(3S,4R)-4-hydroxy-3-(hydroxymethyl)-3-(3-methoxypropyl)piperidine-1-carbonyl]phenyl]pyrrolidin-2-one |
| SMILES | COCCC[C@@]1(CO)CN(C(=O)c2cccc(N3CCCC3=O)c2)CC[C@H]1O |
| InChI | InChI=1S/C21H30N2O5/c1-28-12-4-9-21(15-24)14-22(11-8-18(21)25)20(27)16-5-2-6-17(13-16)23-10-3-7-19(23)26/h2,5-6,13,18,24-25H,3-4,7-12,14-15H2,1H3/t18-,21+/m1/s1 |
| InChIKey | BWJJXPQPRVDPAK-NQIIRXRSSA-N |
| XLogP | 1.43 |
| TPSA | 90.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.48 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|