C18H24N2O4S — CID 155503436
1,3-benzothiazol-6-yl-[(3S,4R)-4-hydroxy-3-(hydroxymethyl)-3-(3-methoxypropyl)piperidin-1-yl]methanone (PubChem CID 155503436) has the molecular formula C18H24N2O4S and a molecular weight of 364.47 g/mol. Its IUPAC name is 1,3-benzothiazol-6-yl-[(3S,4R)-4-hydroxy-3-(hydroxymethyl)-3-(3-methoxypropyl)piperidin-1-yl]methanone.
| Compound Name | 1,3-benzothiazol-6-yl-[(3S,4R)-4-hydroxy-3-(hydroxymethyl)-3-(3-methoxypropyl)piperidin-1-yl]methanone |
|---|---|
| PubChem CID | 155503436 |
| Molecular Formula | C18H24N2O4S |
| Molecular Weight | 364.47 g/mol |
| Exact Mass | 364.15 |
| IUPAC Name | 1,3-benzothiazol-6-yl-[(3S,4R)-4-hydroxy-3-(hydroxymethyl)-3-(3-methoxypropyl)piperidin-1-yl]methanone |
| SMILES | COCCC[C@@]1(CO)CN(C(=O)c2ccc3ncsc3c2)CC[C@H]1O |
| InChI | InChI=1S/C18H24N2O4S/c1-24-8-2-6-18(11-21)10-20(7-5-16(18)22)17(23)13-3-4-14-15(9-13)25-12-19-14/h3-4,9,12,16,21-22H,2,5-8,10-11H2,1H3/t16-,18+/m1/s1 |
| InChIKey | GHJAGBCYSIYPLA-AEFFLSMTSA-N |
| XLogP | 1.91 |
| TPSA | 82.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.47 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|