C24H33NO3 — CID 155497301
(3S,4R)-3-benzyl-3-(hydroxymethyl)-1-(4-phenylmethoxybutyl)piperidin-4-ol (PubChem CID 155497301) has the molecular formula C24H33NO3 and a molecular weight of 383.53 g/mol. Its IUPAC name is (3S,4R)-3-benzyl-3-(hydroxymethyl)-1-(4-phenylmethoxybutyl)piperidin-4-ol.
| Compound Name | (3S,4R)-3-benzyl-3-(hydroxymethyl)-1-(4-phenylmethoxybutyl)piperidin-4-ol |
|---|---|
| PubChem CID | 155497301 |
| Molecular Formula | C24H33NO3 |
| Molecular Weight | 383.53 g/mol |
| Exact Mass | 383.25 |
| IUPAC Name | (3S,4R)-3-benzyl-3-(hydroxymethyl)-1-(4-phenylmethoxybutyl)piperidin-4-ol |
| SMILES | OC[C@]1(Cc2ccccc2)CN(CCCCOCc2ccccc2)CC[C@H]1O |
| InChI | InChI=1S/C24H33NO3/c26-20-24(17-21-9-3-1-4-10-21)19-25(15-13-23(24)27)14-7-8-16-28-18-22-11-5-2-6-12-22/h1-6,9-12,23,26-27H,7-8,13-20H2/t23-,24+/m1/s1 |
| InChIKey | LUTXGPCRSYRWPY-RPWUZVMVSA-N |
| XLogP | 3.27 |
| TPSA | 52.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.53 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|