C17H25NO3S — CID 164698577
(3R,4S)-3-benzyl-4-hydroxy-1-(3-methylsulfanylpropyl)piperidine-3-carboxylic acid (PubChem CID 164698577) has the molecular formula C17H25NO3S and a molecular weight of 323.46 g/mol. Its IUPAC name is (3R,4S)-3-benzyl-4-hydroxy-1-(3-methylsulfanylpropyl)piperidine-3-carboxylic acid.
| Compound Name | (3R,4S)-3-benzyl-4-hydroxy-1-(3-methylsulfanylpropyl)piperidine-3-carboxylic acid |
|---|---|
| PubChem CID | 164698577 |
| Molecular Formula | C17H25NO3S |
| Molecular Weight | 323.46 g/mol |
| Exact Mass | 323.16 |
| IUPAC Name | (3R,4S)-3-benzyl-4-hydroxy-1-(3-methylsulfanylpropyl)piperidine-3-carboxylic acid |
| SMILES | CSCCCN1CC[C@H](O)[C@](Cc2ccccc2)(C(=O)O)C1 |
| InChI | InChI=1S/C17H25NO3S/c1-22-11-5-9-18-10-8-15(19)17(13-18,16(20)21)12-14-6-3-2-4-7-14/h2-4,6-7,15,19H,5,8-13H2,1H3,(H,20,21)/t15-,17+/m0/s1 |
| InChIKey | BFGUMYQJWUMQNU-DOTOQJQBSA-N |
| XLogP | 2.12 |
| TPSA | 60.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.46 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|