C23H27NO4 — CID 164688644
(3R,4S)-3-benzyl-4-hydroxy-1-(4-phenylbutanoyl)piperidine-3-carboxylic acid (PubChem CID 164688644) has the molecular formula C23H27NO4 and a molecular weight of 381.47 g/mol. Its IUPAC name is (3R,4S)-3-benzyl-4-hydroxy-1-(4-phenylbutanoyl)piperidine-3-carboxylic acid.
| Compound Name | (3R,4S)-3-benzyl-4-hydroxy-1-(4-phenylbutanoyl)piperidine-3-carboxylic acid |
|---|---|
| PubChem CID | 164688644 |
| Molecular Formula | C23H27NO4 |
| Molecular Weight | 381.47 g/mol |
| Exact Mass | 381.19 |
| IUPAC Name | (3R,4S)-3-benzyl-4-hydroxy-1-(4-phenylbutanoyl)piperidine-3-carboxylic acid |
| SMILES | O=C(CCCc1ccccc1)N1CC[C@H](O)[C@](Cc2ccccc2)(C(=O)O)C1 |
| InChI | InChI=1S/C23H27NO4/c25-20-14-15-24(21(26)13-7-12-18-8-3-1-4-9-18)17-23(20,22(27)28)16-19-10-5-2-6-11-19/h1-6,8-11,20,25H,7,12-17H2,(H,27,28)/t20-,23+/m0/s1 |
| InChIKey | PPZWQWNATBEMBT-NZQKXSOJSA-N |
| XLogP | 2.92 |
| TPSA | 77.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.47 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |