C21H31NO6 — CID 164695824
(3R,4R)-4-hydroxy-1-(6-methoxyhexanoyl)-3-[(3-methoxyphenyl)methyl]piperidine-3-carboxylic acid (PubChem CID 164695824) has the molecular formula C21H31NO6 and a molecular weight of 393.48 g/mol. Its IUPAC name is (3R,4R)-4-hydroxy-1-(6-methoxyhexanoyl)-3-[(3-methoxyphenyl)methyl]piperidine-3-carboxylic acid.
| Compound Name | (3R,4R)-4-hydroxy-1-(6-methoxyhexanoyl)-3-[(3-methoxyphenyl)methyl]piperidine-3-carboxylic acid |
|---|---|
| PubChem CID | 164695824 |
| Molecular Formula | C21H31NO6 |
| Molecular Weight | 393.48 g/mol |
| Exact Mass | 393.22 |
| IUPAC Name | (3R,4R)-4-hydroxy-1-(6-methoxyhexanoyl)-3-[(3-methoxyphenyl)methyl]piperidine-3-carboxylic acid |
| SMILES | COCCCCCC(=O)N1CC[C@@H](O)[C@](Cc2cccc(OC)c2)(C(=O)O)C1 |
| InChI | InChI=1S/C21H31NO6/c1-27-12-5-3-4-9-19(24)22-11-10-18(23)21(15-22,20(25)26)14-16-7-6-8-17(13-16)28-2/h6-8,13,18,23H,3-5,9-12,14-15H2,1-2H3,(H,25,26)/t18-,21-/m1/s1 |
| InChIKey | FTHKHUBBFBKIKA-WIYYLYMNSA-N |
| XLogP | 2.11 |
| TPSA | 96.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.48 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|