C21H30FNO6 — CID 166599176
(3R,4S)-3-[(4-fluorophenyl)methyl]-4-hydroxy-1-(5-methylhexanoyl)piperidine-3-carboxylic acid;formic acid (PubChem CID 166599176) has the molecular formula C21H30FNO6 and a molecular weight of 411.47 g/mol. Its IUPAC name is (3R,4S)-3-[(4-fluorophenyl)methyl]-4-hydroxy-1-(5-methylhexanoyl)piperidine-3-carboxylic acid;formic acid.
| Compound Name | (3R,4S)-3-[(4-fluorophenyl)methyl]-4-hydroxy-1-(5-methylhexanoyl)piperidine-3-carboxylic acid;formic acid |
|---|---|
| PubChem CID | 166599176 |
| Molecular Formula | C21H30FNO6 |
| Molecular Weight | 411.47 g/mol |
| Exact Mass | 411.21 |
| IUPAC Name | (3R,4S)-3-[(4-fluorophenyl)methyl]-4-hydroxy-1-(5-methylhexanoyl)piperidine-3-carboxylic acid;formic acid |
| SMILES | CC(C)CCCC(=O)N1CC[C@H](O)[C@](Cc2ccc(F)cc2)(C(=O)O)C1.O=CO |
| InChI | InChI=1S/C20H28FNO4.CH2O2/c1-14(2)4-3-5-18(24)22-11-10-17(23)20(13-22,19(25)26)12-15-6-8-16(21)9-7-15;2-1-3/h6-9,14,17,23H,3-5,10-13H2,1-2H3,(H,25,26);1H,(H,2,3)/t17-,20+;/m0./s1 |
| InChIKey | NSWNJEQHAULHSI-YFUYRHFLSA-N |
| XLogP | 2.56 |
| TPSA | 115.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.47 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|