C22H33NO4 — CID 162638323
(3R,4R)-4-hydroxy-3-(3-methylbutyl)-1-(5-phenylpentanoyl)piperidine-3-carboxylic acid (PubChem CID 162638323) has the molecular formula C22H33NO4 and a molecular weight of 375.51 g/mol. Its IUPAC name is (3R,4R)-4-hydroxy-3-(3-methylbutyl)-1-(5-phenylpentanoyl)piperidine-3-carboxylic acid.
| Compound Name | (3R,4R)-4-hydroxy-3-(3-methylbutyl)-1-(5-phenylpentanoyl)piperidine-3-carboxylic acid |
|---|---|
| PubChem CID | 162638323 |
| Molecular Formula | C22H33NO4 |
| Molecular Weight | 375.51 g/mol |
| Exact Mass | 375.24 |
| IUPAC Name | (3R,4R)-4-hydroxy-3-(3-methylbutyl)-1-(5-phenylpentanoyl)piperidine-3-carboxylic acid |
| SMILES | CC(C)CC[C@@]1(C(=O)O)CN(C(=O)CCCCc2ccccc2)CC[C@H]1O |
| InChI | InChI=1S/C22H33NO4/c1-17(2)12-14-22(21(26)27)16-23(15-13-19(22)24)20(25)11-7-6-10-18-8-4-3-5-9-18/h3-5,8-9,17,19,24H,6-7,10-16H2,1-2H3,(H,26,27)/t19-,22-/m1/s1 |
| InChIKey | ZFNSOYFXYOANOS-DENIHFKCSA-N |
| XLogP | 3.50 |
| TPSA | 77.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.51 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|