C22H31N3O4 — CID 155498216
N-[[(1S,5S,6R,7R)-3-(3-ethoxypropanoyl)-10-oxa-3-azatricyclo[5.2.1.01,5]decan-6-yl]methyl]-5,6-dimethylpyridine-3-carboxamide (PubChem CID 155498216) has the molecular formula C22H31N3O4 and a molecular weight of 401.51 g/mol. Its IUPAC name is N-[[(1S,5S,6R,7R)-3-(3-ethoxypropanoyl)-10-oxa-3-azatricyclo[5.2.1.01,5]decan-6-yl]methyl]-5,6-dimethylpyridine-3-carboxamide.
| Compound Name | N-[[(1S,5S,6R,7R)-3-(3-ethoxypropanoyl)-10-oxa-3-azatricyclo[5.2.1.01,5]decan-6-yl]methyl]-5,6-dimethylpyridine-3-carboxamide |
|---|---|
| PubChem CID | 155498216 |
| Molecular Formula | C22H31N3O4 |
| Molecular Weight | 401.51 g/mol |
| Exact Mass | 401.23 |
| IUPAC Name | N-[[(1S,5S,6R,7R)-3-(3-ethoxypropanoyl)-10-oxa-3-azatricyclo[5.2.1.01,5]decan-6-yl]methyl]-5,6-dimethylpyridine-3-carboxamide |
| SMILES | CCOCCC(=O)N1C[C@@H]2[C@H](CNC(=O)c3cnc(C)c(C)c3)[C@H]3CC[C@]2(C1)O3 |
| InChI | InChI=1S/C22H31N3O4/c1-4-28-8-6-20(26)25-12-18-17(19-5-7-22(18,13-25)29-19)11-24-21(27)16-9-14(2)15(3)23-10-16/h9-10,17-19H,4-8,11-13H2,1-3H3,(H,24,27)/t17-,18+,19+,22+/m0/s1 |
| InChIKey | PRYULIHYAZPRLV-JZJXAQOMSA-N |
| XLogP | 1.86 |
| TPSA | 80.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.51 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|