C17H28N4O3 — CID 155499903
3-[(4-methoxypiperidin-1-yl)methyl]-1-(4-methoxypyrimidin-2-yl)piperidin-3-ol (PubChem CID 155499903) has the molecular formula C17H28N4O3 and a molecular weight of 336.44 g/mol. Its IUPAC name is 3-[(4-methoxypiperidin-1-yl)methyl]-1-(4-methoxypyrimidin-2-yl)piperidin-3-ol.
| Compound Name | 3-[(4-methoxypiperidin-1-yl)methyl]-1-(4-methoxypyrimidin-2-yl)piperidin-3-ol |
|---|---|
| PubChem CID | 155499903 |
| Molecular Formula | C17H28N4O3 |
| Molecular Weight | 336.44 g/mol |
| Exact Mass | 336.22 |
| IUPAC Name | 3-[(4-methoxypiperidin-1-yl)methyl]-1-(4-methoxypyrimidin-2-yl)piperidin-3-ol |
| SMILES | COc1ccnc(N2CCCC(O)(CN3CCC(OC)CC3)C2)n1 |
| InChI | InChI=1S/C17H28N4O3/c1-23-14-5-10-20(11-6-14)12-17(22)7-3-9-21(13-17)16-18-8-4-15(19-16)24-2/h4,8,14,22H,3,5-7,9-13H2,1-2H3 |
| InChIKey | MEOHCHCNAWBRHS-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 70.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.44 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |