C17H16N6OS — CID 155501287
2-amino-N-[3-([1,2,4]triazolo[4,3-a]pyridin-3-yl)propyl]-1,3-benzothiazole-5-carboxamide (PubChem CID 155501287) has the molecular formula C17H16N6OS and a molecular weight of 352.42 g/mol. Its IUPAC name is 2-amino-N-[3-([1,2,4]triazolo[4,3-a]pyridin-3-yl)propyl]-1,3-benzothiazole-5-carboxamide.
| Compound Name | 2-amino-N-[3-([1,2,4]triazolo[4,3-a]pyridin-3-yl)propyl]-1,3-benzothiazole-5-carboxamide |
|---|---|
| PubChem CID | 155501287 |
| Molecular Formula | C17H16N6OS |
| Molecular Weight | 352.42 g/mol |
| Exact Mass | 352.11 |
| IUPAC Name | 2-amino-N-[3-([1,2,4]triazolo[4,3-a]pyridin-3-yl)propyl]-1,3-benzothiazole-5-carboxamide |
| SMILES | Nc1nc2cc(C(=O)NCCCc3nnc4ccccn34)ccc2s1 |
| InChI | InChI=1S/C17H16N6OS/c18-17-20-12-10-11(6-7-13(12)25-17)16(24)19-8-3-5-15-22-21-14-4-1-2-9-23(14)15/h1-2,4,6-7,9-10H,3,5,8H2,(H2,18,20)(H,19,24) |
| InChIKey | IUXJBYRRUPRCJR-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 98.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.42 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|