C19H19N5O — CID 71702523
1-methyl-N-[3-([1,2,4]triazolo[4,3-a]pyridin-3-yl)propyl]indole-6-carboxamide (PubChem CID 71702523) has the molecular formula C19H19N5O and a molecular weight of 333.40 g/mol. Its IUPAC name is 1-methyl-N-[3-([1,2,4]triazolo[4,3-a]pyridin-3-yl)propyl]indole-6-carboxamide.
| Compound Name | 1-methyl-N-[3-([1,2,4]triazolo[4,3-a]pyridin-3-yl)propyl]indole-6-carboxamide |
|---|---|
| PubChem CID | 71702523 |
| Molecular Formula | C19H19N5O |
| Molecular Weight | 333.40 g/mol |
| Exact Mass | 333.16 |
| IUPAC Name | 1-methyl-N-[3-([1,2,4]triazolo[4,3-a]pyridin-3-yl)propyl]indole-6-carboxamide |
| SMILES | Cn1ccc2ccc(C(=O)NCCCc3nnc4ccccn34)cc21 |
| InChI | InChI=1S/C19H19N5O/c1-23-12-9-14-7-8-15(13-16(14)23)19(25)20-10-4-6-18-22-21-17-5-2-3-11-24(17)18/h2-3,5,7-9,11-13H,4,6,10H2,1H3,(H,20,25) |
| InChIKey | ULEBKRFQUPQTTP-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 64.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.40 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|